C13H23N5 — CID 58227319
4-[(3S)-3-(methylamino)pyrrolidin-1-yl]-N-(2-methylpropyl)pyrimidin-2-amine (PubChem CID 58227319) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-[(3S)-3-(methylamino)pyrrolidin-1-yl]-N-(2-methylpropyl)pyrimidin-2-amine.
| Compound Name | 4-[(3S)-3-(methylamino)pyrrolidin-1-yl]-N-(2-methylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 58227319 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 4-[(3S)-3-(methylamino)pyrrolidin-1-yl]-N-(2-methylpropyl)pyrimidin-2-amine |
| SMILES | CN[C@H]1CCN(c2ccnc(NCC(C)C)n2)C1 |
| InChI | InChI=1S/C13H23N5/c1-10(2)8-16-13-15-6-4-12(17-13)18-7-5-11(9-18)14-3/h4,6,10-11,14H,5,7-9H2,1-3H3,(H,15,16,17)/t11-/m0/s1 |
| InChIKey | ROOXXUYZFBALHV-NSHDSACASA-N |
| XLogP | 1.34 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |