C21H21FN2O2 — CID 56750367
2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[[2-(2-fluorophenoxy)-3-pyridinyl]methyl]acetamide (PubChem CID 56750367) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[[2-(2-fluorophenoxy)-3-pyridinyl]methyl]acetamide.
| Compound Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[[2-(2-fluorophenoxy)-3-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 56750367 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-[[2-(2-fluorophenoxy)-3-pyridinyl]methyl]acetamide |
| SMILES | O=C(C[C@@H]1C[C@@H]2C=C[C@H]1C2)NCc1cccnc1Oc1ccccc1F |
| InChI | InChI=1S/C21H21FN2O2/c22-18-5-1-2-6-19(18)26-21-16(4-3-9-23-21)13-24-20(25)12-17-11-14-7-8-15(17)10-14/h1-9,14-15,17H,10-13H2,(H,24,25)/t14-,15+,17+/m1/s1 |
| InChIKey | HLWPOVUPZNMUGF-VYDXJSESSA-N |
| XLogP | 4.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|