C21H24N4O — CID 56750793
(2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(1,3-dimethylindol-2-yl)methanone (PubChem CID 56750793) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(1,3-dimethylindol-2-yl)methanone.
| Compound Name | (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(1,3-dimethylindol-2-yl)methanone |
|---|---|
| PubChem CID | 56750793 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2-tert-butyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-(1,3-dimethylindol-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2Cc3cnc(C(C)(C)C)nc3C2)n(C)c2ccccc12 |
| InChI | InChI=1S/C21H24N4O/c1-13-15-8-6-7-9-17(15)24(5)18(13)19(26)25-11-14-10-22-20(21(2,3)4)23-16(14)12-25/h6-10H,11-12H2,1-5H3 |
| InChIKey | JJGIRZYRQJFLQH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|