About tritert-butyl phosphate
tritert-butyl phosphate (PubChem CID 567509) has the molecular formula C12H27O4P
and a molecular weight of 266.32 g/mol. Its IUPAC name is tritert-butyl phosphate.
Molecular Properties
| Compound Name | tritert-butyl phosphate |
| PubChem CID | 567509 |
| Molecular Formula | C12H27O4P |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | tritert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C12H27O4P/c1-10(2,3)14-17(13,15-11(4,5)6)16-12(7,8)9/h1-9H3 |
| InChIKey | CQXYINNETWHZTR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tritert-butyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tritert-butyl phosphate?
The IUPAC name of tritert-butyl phosphate (CID 567509) is tritert-butyl phosphate.
What is the SMILES notation for tritert-butyl phosphate?
The canonical SMILES for tritert-butyl phosphate is CC(C)(C)OP(=O)(OC(C)(C)C)OC(C)(C)C.
What is the InChIKey of tritert-butyl phosphate?
The InChIKey is CQXYINNETWHZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27O4P/c1-10(2,3)14-17(13,15-11(4,5)6)16-12(7,8)9/h1-9H3.
What are the key properties of tritert-butyl phosphate?
tritert-butyl phosphate has a molecular weight of 266.32 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tritert-butyl phosphate is sourced from PubChem (CID 567509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).