C17H26N4O2 — CID 56754877
N-[1-(3-hydroxy-1-adamantyl)ethyl]-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 56754877) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[1-(3-hydroxy-1-adamantyl)ethyl]-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[1-(3-hydroxy-1-adamantyl)ethyl]-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 56754877 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-[1-(3-hydroxy-1-adamantyl)ethyl]-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(NC(=O)CCn1cncn1)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C17H26N4O2/c1-12(20-15(22)2-3-21-11-18-10-19-21)16-5-13-4-14(6-16)8-17(23,7-13)9-16/h10-14,23H,2-9H2,1H3,(H,20,22) |
| InChIKey | GJIQCYKUOABJSO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |