C18H20N4O2 — CID 56757318
9-(isoquinoline-5-carbonyl)-1,4,9-triazaspiro[5.5]undecan-5-one (PubChem CID 56757318) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 9-(isoquinoline-5-carbonyl)-1,4,9-triazaspiro[5.5]undecan-5-one.
| Compound Name | 9-(isoquinoline-5-carbonyl)-1,4,9-triazaspiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 56757318 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 9-(isoquinoline-5-carbonyl)-1,4,9-triazaspiro[5.5]undecan-5-one |
| SMILES | O=C(c1cccc2cnccc12)N1CCC2(CC1)NCCNC2=O |
| InChI | InChI=1S/C18H20N4O2/c23-16(15-3-1-2-13-12-19-7-4-14(13)15)22-10-5-18(6-11-22)17(24)20-8-9-21-18/h1-4,7,12,21H,5-6,8-11H2,(H,20,24) |
| InChIKey | UXQNPBAFBGFZHG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |