C15H16N2O3 — CID 56882612
[(3S,4S)-3,4-dihydroxypiperidin-1-yl]-isoquinolin-5-ylmethanone (PubChem CID 56882612) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is [(3S,4S)-3,4-dihydroxypiperidin-1-yl]-isoquinolin-5-ylmethanone.
| Compound Name | [(3S,4S)-3,4-dihydroxypiperidin-1-yl]-isoquinolin-5-ylmethanone |
|---|---|
| PubChem CID | 56882612 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [(3S,4S)-3,4-dihydroxypiperidin-1-yl]-isoquinolin-5-ylmethanone |
| SMILES | O=C(c1cccc2cnccc12)N1CC[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C15H16N2O3/c18-13-5-7-17(9-14(13)19)15(20)12-3-1-2-10-8-16-6-4-11(10)12/h1-4,6,8,13-14,18-19H,5,7,9H2/t13-,14-/m0/s1 |
| InChIKey | RATAXMLKGZZRSD-KBPBESRZSA-N |
| XLogP | 0.80 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |