C17H21N3O3S — CID 146086773
1-(isoquinoline-5-carbonyl)-N,N-dimethylpiperidine-3-sulfonamide (PubChem CID 146086773) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-(isoquinoline-5-carbonyl)-N,N-dimethylpiperidine-3-sulfonamide.
| Compound Name | 1-(isoquinoline-5-carbonyl)-N,N-dimethylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 146086773 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-(isoquinoline-5-carbonyl)-N,N-dimethylpiperidine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)C1CCCN(C(=O)c2cccc3cnccc23)C1 |
| InChI | InChI=1S/C17H21N3O3S/c1-19(2)24(22,23)14-6-4-10-20(12-14)17(21)16-7-3-5-13-11-18-9-8-15(13)16/h3,5,7-9,11,14H,4,6,10,12H2,1-2H3 |
| InChIKey | BJHMYYPVHJLCRO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |