C18H21ClN4O3S — CID 97348630
(3R)-1-(3-chlorobenzoyl)-N-methyl-N-(pyrazin-2-ylmethyl)piperidine-3-sulfonamide (PubChem CID 97348630) has the molecular formula C18H21ClN4O3S and a molecular weight of 408.91 g/mol. Its IUPAC name is (3R)-1-(3-chlorobenzoyl)-N-methyl-N-(pyrazin-2-ylmethyl)piperidine-3-sulfonamide.
| Compound Name | (3R)-1-(3-chlorobenzoyl)-N-methyl-N-(pyrazin-2-ylmethyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348630 |
| Molecular Formula | C18H21ClN4O3S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (3R)-1-(3-chlorobenzoyl)-N-methyl-N-(pyrazin-2-ylmethyl)piperidine-3-sulfonamide |
| SMILES | CN(Cc1cnccn1)S(=O)(=O)[C@@H]1CCCN(C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H21ClN4O3S/c1-22(12-16-11-20-7-8-21-16)27(25,26)17-6-3-9-23(13-17)18(24)14-4-2-5-15(19)10-14/h2,4-5,7-8,10-11,17H,3,6,9,12-13H2,1H3/t17-/m1/s1 |
| InChIKey | NKXNUOYPKRAMMY-QGZVFWFLSA-N |
| XLogP | 2.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |