C20H26N4O2 — CID 56757453
9-[4-(1H-indol-3-yl)butanoyl]-1,4,9-triazaspiro[5.5]undecan-5-one (PubChem CID 56757453) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 9-[4-(1H-indol-3-yl)butanoyl]-1,4,9-triazaspiro[5.5]undecan-5-one.
| Compound Name | 9-[4-(1H-indol-3-yl)butanoyl]-1,4,9-triazaspiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 56757453 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 9-[4-(1H-indol-3-yl)butanoyl]-1,4,9-triazaspiro[5.5]undecan-5-one |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)N1CCC2(CC1)NCCNC2=O |
| InChI | InChI=1S/C20H26N4O2/c25-18(7-3-4-15-14-22-17-6-2-1-5-16(15)17)24-12-8-20(9-13-24)19(26)21-10-11-23-20/h1-2,5-6,14,22-23H,3-4,7-13H2,(H,21,26) |
| InChIKey | ZSELEUYRODBCMR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |