C15H18ClN7O2 — CID 56758867
2-chloro-N-[[1-[(3S,5S)-5-(methylcarbamoyl)pyrrolidin-3-yl]triazol-4-yl]methyl]pyridine-4-carboxamide (PubChem CID 56758867) has the molecular formula C15H18ClN7O2 and a molecular weight of 363.81 g/mol. Its IUPAC name is 2-chloro-N-[[1-[(3S,5S)-5-(methylcarbamoyl)pyrrolidin-3-yl]triazol-4-yl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[[1-[(3S,5S)-5-(methylcarbamoyl)pyrrolidin-3-yl]triazol-4-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 56758867 |
| Molecular Formula | C15H18ClN7O2 |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-chloro-N-[[1-[(3S,5S)-5-(methylcarbamoyl)pyrrolidin-3-yl]triazol-4-yl]methyl]pyridine-4-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@H](n2cc(CNC(=O)c3ccnc(Cl)c3)nn2)CN1 |
| InChI | InChI=1S/C15H18ClN7O2/c1-17-15(25)12-5-11(7-19-12)23-8-10(21-22-23)6-20-14(24)9-2-3-18-13(16)4-9/h2-4,8,11-12,19H,5-7H2,1H3,(H,17,25)(H,20,24)/t11-,12-/m0/s1 |
| InChIKey | BRVNEXMLSDPAFV-RYUDHWBXSA-N |
| XLogP | -0.09 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|