C22H25ClN2O2 — CID 56759520
1-[1-[6-(3-chlorophenyl)pyridine-3-carbonyl]piperidin-3-yl]-3-methylbutan-1-one (PubChem CID 56759520) has the molecular formula C22H25ClN2O2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 1-[1-[6-(3-chlorophenyl)pyridine-3-carbonyl]piperidin-3-yl]-3-methylbutan-1-one.
| Compound Name | 1-[1-[6-(3-chlorophenyl)pyridine-3-carbonyl]piperidin-3-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 56759520 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[1-[6-(3-chlorophenyl)pyridine-3-carbonyl]piperidin-3-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)C1CCCN(C(=O)c2ccc(-c3cccc(Cl)c3)nc2)C1 |
| InChI | InChI=1S/C22H25ClN2O2/c1-15(2)11-21(26)18-6-4-10-25(14-18)22(27)17-8-9-20(24-13-17)16-5-3-7-19(23)12-16/h3,5,7-9,12-13,15,18H,4,6,10-11,14H2,1-2H3 |
| InChIKey | WWGYQBMZFNPGSB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |