C24H26N2O3 — CID 56741654
1-[1-[6-(1-benzofuran-2-yl)pyridine-3-carbonyl]piperidin-3-yl]-3-methylbutan-1-one (PubChem CID 56741654) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-[1-[6-(1-benzofuran-2-yl)pyridine-3-carbonyl]piperidin-3-yl]-3-methylbutan-1-one.
| Compound Name | 1-[1-[6-(1-benzofuran-2-yl)pyridine-3-carbonyl]piperidin-3-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 56741654 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[1-[6-(1-benzofuran-2-yl)pyridine-3-carbonyl]piperidin-3-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)C1CCCN(C(=O)c2ccc(-c3cc4ccccc4o3)nc2)C1 |
| InChI | InChI=1S/C24H26N2O3/c1-16(2)12-21(27)19-7-5-11-26(15-19)24(28)18-9-10-20(25-14-18)23-13-17-6-3-4-8-22(17)29-23/h3-4,6,8-10,13-14,16,19H,5,7,11-12,15H2,1-2H3 |
| InChIKey | LMECVLYJUBBLSD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |