C21H19FN2O3 — CID 56764164
N'-(3-fluoro-4-methylphenyl)-N-(2-hydroxy-2-naphthalen-1-ylethyl)oxamide (PubChem CID 56764164) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is N'-(3-fluoro-4-methylphenyl)-N-(2-hydroxy-2-naphthalen-1-ylethyl)oxamide.
| Compound Name | N'-(3-fluoro-4-methylphenyl)-N-(2-hydroxy-2-naphthalen-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 56764164 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N'-(3-fluoro-4-methylphenyl)-N-(2-hydroxy-2-naphthalen-1-ylethyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC(O)c2cccc3ccccc23)cc1F |
| InChI | InChI=1S/C21H19FN2O3/c1-13-9-10-15(11-18(13)22)24-21(27)20(26)23-12-19(25)17-8-4-6-14-5-2-3-7-16(14)17/h2-11,19,25H,12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | HPDLWYLMQLZNSD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|