C24H29N2O5S+ — CID 56766057
6-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid (PubChem CID 56766057) has the molecular formula C24H29N2O5S+ and a molecular weight of 457.57 g/mol. Its IUPAC name is 6-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 56766057 |
| Molecular Formula | C24H29N2O5S+ |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 6-[2-[(E)-2-anilinoethenyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
| SMILES | CC1(C)C(/C=C/Nc2ccccc2)=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C24H28N2O5S/c1-24(2)20-17-19(32(29,30)31)12-13-21(20)26(16-8-4-7-11-23(27)28)22(24)14-15-25-18-9-5-3-6-10-18/h3,5-6,9-10,12-15,17H,4,7-8,11,16H2,1-2H3,(H2,27,28,29,30,31)/p+1 |
| InChIKey | YUHQTCLZYKFOOX-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|