C10H11N5O2S — CID 56772790
3-amino-4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid (PubChem CID 56772790) has the molecular formula C10H11N5O2S and a molecular weight of 265.30 g/mol. Its IUPAC name is 3-amino-4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid.
| Compound Name | 3-amino-4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 56772790 |
| Molecular Formula | C10H11N5O2S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-amino-4-[(4-amino-5-methyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid |
| SMILES | Cc1nnc(Sc2ccc(C(=O)O)cc2N)n1N |
| InChI | InChI=1S/C10H11N5O2S/c1-5-13-14-10(15(5)12)18-8-3-2-6(9(16)17)4-7(8)11/h2-4H,11-12H2,1H3,(H,16,17) |
| InChIKey | RJDGQKVBIQLGFC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|