C11H11N3O2S — CID 55218640
4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid (PubChem CID 55218640) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid.
| Compound Name | 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 55218640 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]benzoic acid |
| SMILES | Cc1nnc(Sc2ccc(C(=O)O)cc2)n1C |
| InChI | InChI=1S/C11H11N3O2S/c1-7-12-13-11(14(7)2)17-9-5-3-8(4-6-9)10(15)16/h3-6H,1-2H3,(H,15,16) |
| InChIKey | GDKBEPJRCNFNLZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |