C20H24N2O6 — CID 56774918
N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]furan-2-carboxamide (PubChem CID 56774918) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56774918 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]furan-2-carboxamide |
| SMILES | CCOCCN1C(=O)COC[C@@H]1[C@H](O)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C20H24N2O6/c1-2-26-11-9-22-16(12-27-13-18(22)23)19(24)14-5-7-15(8-6-14)21-20(25)17-4-3-10-28-17/h3-8,10,16,19,24H,2,9,11-13H2,1H3,(H,21,25)/t16-,19-/m1/s1 |
| InChIKey | LPPDQBDKKBJUDX-VQIMIIECSA-N |
| XLogP | 1.83 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|