C23H28N2O6 — CID 56774920
N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-methoxybenzamide (PubChem CID 56774920) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-methoxybenzamide.
| Compound Name | N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 56774920 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-methoxybenzamide |
| SMILES | CCOCCN1C(=O)COC[C@@H]1[C@H](O)c1ccc(NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C23H28N2O6/c1-3-30-13-12-25-19(14-31-15-21(25)26)22(27)16-8-10-17(11-9-16)24-23(28)18-6-4-5-7-20(18)29-2/h4-11,19,22,27H,3,12-15H2,1-2H3,(H,24,28)/t19-,22-/m1/s1 |
| InChIKey | RQTAQVYRKYRBBY-DENIHFKCSA-N |
| XLogP | 2.24 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|