C21H32N2O5 — CID 56774911
N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-ethylbutanamide (PubChem CID 56774911) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-ethylbutanamide.
| Compound Name | N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 56774911 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | N-[4-[(R)-[(3R)-4-(2-ethoxyethyl)-5-oxomorpholin-3-yl]-hydroxymethyl]phenyl]-2-ethylbutanamide |
| SMILES | CCOCCN1C(=O)COC[C@@H]1[C@H](O)c1ccc(NC(=O)C(CC)CC)cc1 |
| InChI | InChI=1S/C21H32N2O5/c1-4-15(5-2)21(26)22-17-9-7-16(8-10-17)20(25)18-13-28-14-19(24)23(18)11-12-27-6-3/h7-10,15,18,20,25H,4-6,11-14H2,1-3H3,(H,22,26)/t18-,20-/m1/s1 |
| InChIKey | QUBIOGONZCHUID-UYAOXDASSA-N |
| XLogP | 2.36 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|