2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid

C10H19NO5 — CID 567793

IUPAC2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid
SMILESCCN(CC)C(=O)COCCOCC(=O)O
InChIInChI=1S/C10H19NO5/c1-3-11(4-2)9(12)7-15-5-6-16-8-10(13)14/h3-8H2,1-2H3,(H,13,14)
InChIKeyRKPGPMZEEPNUMJ-UHFFFAOYSA-N
MW233.26 g/mol
LogP-0.03
Rot. Bonds9

About 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid

2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid (PubChem CID 567793) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid
PubChem CID567793
Molecular FormulaC10H19NO5
Molecular Weight233.26 g/mol
Exact Mass233.13
IUPAC Name2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid
SMILESCCN(CC)C(=O)COCCOCC(=O)O
InChIInChI=1S/C10H19NO5/c1-3-11(4-2)9(12)7-15-5-6-16-8-10(13)14/h3-8H2,1-2H3,(H,13,14)
InChIKeyRKPGPMZEEPNUMJ-UHFFFAOYSA-N
XLogP-0.03
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.26
LogP ≤ 5-0.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic acid
CID 51340918
[2-(N-Boc-N-methyl-amino)-ethoxy]-acetic acid
CID 18442965
[2-(Diethylamino)-2-oxoethoxy]acetic acid
CID 7320778
N,N,N',N'-Tetraethyl-3,6-dioxaoctanediamide
CID 12855435
N,N-diethylacetoxyacetamide
CID 19735944
[2-(Dimethylamino)-2-oxoethoxy]acetic acid
CID 24214097
(2-Oxo-2-pyrrolidin-1-ylethoxy)acetic acid
CID 33697701
2-[2-[Carbonofluoridoyl(methyl)amino]ethoxy]acetic acid
CID 130374956
2-[2-[2-[Methyl-(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetic acid
CID 177028617
N,N-diethyl-2-(2-hydroxyethoxy)acetamide
CID 12424331
2-[2-Oxo-2-[propyl(2,2,2-trifluoroethyl)amino]ethoxy]acetic acid
CID 55150172
2-[2-Oxo-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]ethoxy]acetic acid
CID 61326913

Frequently Asked Questions

What is the IUPAC name of 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid?
The IUPAC name of 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid (CID 567793) is 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid.
What is the SMILES notation for 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid?
The canonical SMILES for 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid is CCN(CC)C(=O)COCCOCC(=O)O.
What is the InChIKey of 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid?
The InChIKey is RKPGPMZEEPNUMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO5/c1-3-11(4-2)9(12)7-15-5-6-16-8-10(13)14/h3-8H2,1-2H3,(H,13,14).
What are the key properties of 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid?
2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid has a molecular weight of 233.26 g/mol, XLogP of -0.03, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(diethylamino)-2-oxoethoxy]ethoxy]acetic acid is sourced from PubChem (CID 567793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).