C16H20N4O2S — CID 56779315
N-[[5-[2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]thiophen-2-yl]methyl]acetamide (PubChem CID 56779315) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-[[5-[2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 56779315 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[[5-[2-(pyrazol-1-ylmethyl)pyrrolidine-1-carbonyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(=O)N2CCCC2Cn2cccn2)s1 |
| InChI | InChI=1S/C16H20N4O2S/c1-12(21)17-10-14-5-6-15(23-14)16(22)20-9-2-4-13(20)11-19-8-3-7-18-19/h3,5-8,13H,2,4,9-11H2,1H3,(H,17,21) |
| InChIKey | VGNYOMYUVZVQBC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |