C15H22F3N5O — CID 56780017
1-[4-[methyl(pyridazin-3-yl)amino]piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one (PubChem CID 56780017) has the molecular formula C15H22F3N5O and a molecular weight of 345.37 g/mol. Its IUPAC name is 1-[4-[methyl(pyridazin-3-yl)amino]piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one.
| Compound Name | 1-[4-[methyl(pyridazin-3-yl)amino]piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one |
|---|---|
| PubChem CID | 56780017 |
| Molecular Formula | C15H22F3N5O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 1-[4-[methyl(pyridazin-3-yl)amino]piperidin-1-yl]-3-(2,2,2-trifluoroethylamino)propan-1-one |
| SMILES | CN(c1cccnn1)C1CCN(C(=O)CCNCC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H22F3N5O/c1-22(13-3-2-7-20-21-13)12-5-9-23(10-6-12)14(24)4-8-19-11-15(16,17)18/h2-3,7,12,19H,4-6,8-11H2,1H3 |
| InChIKey | GSSGTAVTWGJQQD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|