C13H23N3O3 — CID 56781493
1-(2,2-dimethylpropyl)-3-[3-(2,5-dioxopyrrolidin-1-yl)propyl]urea (PubChem CID 56781493) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[3-(2,5-dioxopyrrolidin-1-yl)propyl]urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[3-(2,5-dioxopyrrolidin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 56781493 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[3-(2,5-dioxopyrrolidin-1-yl)propyl]urea |
| SMILES | CC(C)(C)CNC(=O)NCCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C13H23N3O3/c1-13(2,3)9-15-12(19)14-7-4-8-16-10(17)5-6-11(16)18/h4-9H2,1-3H3,(H2,14,15,19) |
| InChIKey | KXOZWYUHRBNGRM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|