C14H11N3O4S — CID 56785010
1-prop-2-enyl-3-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 56785010) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-prop-2-enyl-3-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 56785010 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-prop-2-enyl-3-[(5-thiophen-2-yl-1,3-oxazol-2-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | C=CCN1C(=O)C(=O)N(Cc2ncc(-c3cccs3)o2)C1=O |
| InChI | InChI=1S/C14H11N3O4S/c1-2-5-16-12(18)13(19)17(14(16)20)8-11-15-7-9(21-11)10-4-3-6-22-10/h2-4,6-7H,1,5,8H2 |
| InChIKey | FVDHQMWDCHVDOA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|