C15H28N6O2 — CID 56785628
tert-butyl 3-methyl-4-[(1-propyltetrazol-5-yl)methyl]piperazine-1-carboxylate (PubChem CID 56785628) has the molecular formula C15H28N6O2 and a molecular weight of 324.43 g/mol. Its IUPAC name is tert-butyl 3-methyl-4-[(1-propyltetrazol-5-yl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-4-[(1-propyltetrazol-5-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 56785628 |
| Molecular Formula | C15H28N6O2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | tert-butyl 3-methyl-4-[(1-propyltetrazol-5-yl)methyl]piperazine-1-carboxylate |
| SMILES | CCCn1nnnc1CN1CCN(C(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C15H28N6O2/c1-6-7-21-13(16-17-18-21)11-19-8-9-20(10-12(19)2)14(22)23-15(3,4)5/h12H,6-11H2,1-5H3 |
| InChIKey | OMBUJXRTHASHQV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |