C18H19ClN2O2 — CID 56785827
[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 56785827) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.81 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 56785827 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCC(C(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H19ClN2O2/c19-15-6-4-13(5-7-15)17(22)14-8-11-21(12-9-14)18(23)16-3-1-2-10-20-16/h1-7,10,14,17,22H,8-9,11-12H2 |
| InChIKey | ANGSMKQJXNHKDR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |