C17H19ClN4O2 — CID 111112295
(3-aminopyrazin-2-yl)-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]methanone (PubChem CID 111112295) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 111112295 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]methanone |
| SMILES | Nc1nccnc1C(=O)N1CCC(C(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H19ClN4O2/c18-13-3-1-11(2-4-13)15(23)12-5-9-22(10-6-12)17(24)14-16(19)21-8-7-20-14/h1-4,7-8,12,15,23H,5-6,9-10H2,(H2,19,21) |
| InChIKey | KKEBMNURPUBPTO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |