C18H25N3OS — CID 56788100
2-benzyl-5-[(3-ethylsulfanylazepan-1-yl)methyl]-1,3,4-oxadiazole (PubChem CID 56788100) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-benzyl-5-[(3-ethylsulfanylazepan-1-yl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-benzyl-5-[(3-ethylsulfanylazepan-1-yl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 56788100 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-benzyl-5-[(3-ethylsulfanylazepan-1-yl)methyl]-1,3,4-oxadiazole |
| SMILES | CCSC1CCCCN(Cc2nnc(Cc3ccccc3)o2)C1 |
| InChI | InChI=1S/C18H25N3OS/c1-2-23-16-10-6-7-11-21(13-16)14-18-20-19-17(22-18)12-15-8-4-3-5-9-15/h3-5,8-9,16H,2,6-7,10-14H2,1H3 |
| InChIKey | KVFRFWQNRDYSSM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |