C19H25N3O — CID 124732368
2-[[(2R,3aS,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methyl]-5-benzyl-1,3,4-oxadiazole (PubChem CID 124732368) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-[[(2R,3aS,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methyl]-5-benzyl-1,3,4-oxadiazole.
| Compound Name | 2-[[(2R,3aS,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methyl]-5-benzyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 124732368 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-[[(2R,3aS,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]methyl]-5-benzyl-1,3,4-oxadiazole |
| SMILES | C[C@@H]1C[C@@H]2CCCC[C@H]2N1Cc1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C19H25N3O/c1-14-11-16-9-5-6-10-17(16)22(14)13-19-21-20-18(23-19)12-15-7-3-2-4-8-15/h2-4,7-8,14,16-17H,5-6,9-13H2,1H3/t14-,16+,17-/m1/s1 |
| InChIKey | JMYNPIRIZRDSJX-HYVNUMGLSA-N |
| XLogP | 3.81 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |