C22H26N4O — CID 110653399
N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-4-(4-methylpiperidin-1-yl)aniline (PubChem CID 110653399) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-4-(4-methylpiperidin-1-yl)aniline.
| Compound Name | N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-4-(4-methylpiperidin-1-yl)aniline |
|---|---|
| PubChem CID | 110653399 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-[(5-benzyl-1,3,4-oxadiazol-2-yl)methyl]-4-(4-methylpiperidin-1-yl)aniline |
| SMILES | CC1CCN(c2ccc(NCc3nnc(Cc4ccccc4)o3)cc2)CC1 |
| InChI | InChI=1S/C22H26N4O/c1-17-11-13-26(14-12-17)20-9-7-19(8-10-20)23-16-22-25-24-21(27-22)15-18-5-3-2-4-6-18/h2-10,17,23H,11-16H2,1H3 |
| InChIKey | VJCZVOZXKWLNCG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|