C20H31NO4 — CID 56791697
N-[(2-tert-butyloxolan-3-yl)methyl]-2-[(3-methoxyphenyl)methoxy]propanamide (PubChem CID 56791697) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is N-[(2-tert-butyloxolan-3-yl)methyl]-2-[(3-methoxyphenyl)methoxy]propanamide.
| Compound Name | N-[(2-tert-butyloxolan-3-yl)methyl]-2-[(3-methoxyphenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 56791697 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | N-[(2-tert-butyloxolan-3-yl)methyl]-2-[(3-methoxyphenyl)methoxy]propanamide |
| SMILES | COc1cccc(COC(C)C(=O)NCC2CCOC2C(C)(C)C)c1 |
| InChI | InChI=1S/C20H31NO4/c1-14(25-13-15-7-6-8-17(11-15)23-5)19(22)21-12-16-9-10-24-18(16)20(2,3)4/h6-8,11,14,16,18H,9-10,12-13H2,1-5H3,(H,21,22) |
| InChIKey | XFMKXZAVMCINQY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |