C13H10ClN3OS2 — CID 56792037
2-(3-chlorophenyl)-5-[1-(1,3-thiazol-2-ylsulfanyl)ethyl]-1,3,4-oxadiazole (PubChem CID 56792037) has the molecular formula C13H10ClN3OS2 and a molecular weight of 323.83 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-[1-(1,3-thiazol-2-ylsulfanyl)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-chlorophenyl)-5-[1-(1,3-thiazol-2-ylsulfanyl)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 56792037 |
| Molecular Formula | C13H10ClN3OS2 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2-(3-chlorophenyl)-5-[1-(1,3-thiazol-2-ylsulfanyl)ethyl]-1,3,4-oxadiazole |
| SMILES | CC(Sc1nccs1)c1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C13H10ClN3OS2/c1-8(20-13-15-5-6-19-13)11-16-17-12(18-11)9-3-2-4-10(14)7-9/h2-8H,1H3 |
| InChIKey | OYWUHIRTNVUCLV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|