C17H23N5O3 — CID 56792182
N-[(1-butyltetrazol-5-yl)methyl]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 56792182) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[(1-butyltetrazol-5-yl)methyl]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(1-butyltetrazol-5-yl)methyl]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 56792182 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[(1-butyltetrazol-5-yl)methyl]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NCc2nnnn2CCCC)cc1OC |
| InChI | InChI=1S/C17H23N5O3/c1-4-6-9-22-16(19-20-21-22)12-18-17(23)13-7-8-14(25-10-5-2)15(11-13)24-3/h5,7-8,11H,2,4,6,9-10,12H2,1,3H3,(H,18,23) |
| InChIKey | BJNCHWBNIVHBLP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|