C17H22FN5O2 — CID 56793041
1-[(3-fluorophenyl)methyl]-3-[1-(2-morpholin-4-ylethyl)pyrazol-3-yl]urea (PubChem CID 56793041) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-[1-(2-morpholin-4-ylethyl)pyrazol-3-yl]urea.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-[1-(2-morpholin-4-ylethyl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 56793041 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-[1-(2-morpholin-4-ylethyl)pyrazol-3-yl]urea |
| SMILES | O=C(NCc1cccc(F)c1)Nc1ccn(CCN2CCOCC2)n1 |
| InChI | InChI=1S/C17H22FN5O2/c18-15-3-1-2-14(12-15)13-19-17(24)20-16-4-5-23(21-16)7-6-22-8-10-25-11-9-22/h1-5,12H,6-11,13H2,(H2,19,20,21,24) |
| InChIKey | PRAWASCQQAKRQV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |