C17H28N4O2 — CID 56793069
4-(3-methoxypropyl)-N-(2-pyridin-2-ylethyl)-1,4-diazepane-1-carboxamide (PubChem CID 56793069) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-N-(2-pyridin-2-ylethyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-(3-methoxypropyl)-N-(2-pyridin-2-ylethyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 56793069 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 4-(3-methoxypropyl)-N-(2-pyridin-2-ylethyl)-1,4-diazepane-1-carboxamide |
| SMILES | COCCCN1CCCN(C(=O)NCCc2ccccn2)CC1 |
| InChI | InChI=1S/C17H28N4O2/c1-23-15-5-11-20-10-4-12-21(14-13-20)17(22)19-9-7-16-6-2-3-8-18-16/h2-3,6,8H,4-5,7,9-15H2,1H3,(H,19,22) |
| InChIKey | ZXVGNUHMQFKEJQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|