C14H18ClN5O — CID 56793753
1-[5-chloro-2-(dimethylamino)phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 56793753) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 1-[5-chloro-2-(dimethylamino)phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-[5-chloro-2-(dimethylamino)phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 56793753 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-[5-chloro-2-(dimethylamino)phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | CN(C)c1ccc(Cl)cc1NC(=O)NCc1cnn(C)c1 |
| InChI | InChI=1S/C14H18ClN5O/c1-19(2)13-5-4-11(15)6-12(13)18-14(21)16-7-10-8-17-20(3)9-10/h4-6,8-9H,7H2,1-3H3,(H2,16,18,21) |
| InChIKey | PDFBBADXOMOZDJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |