C17H20ClN5O3 — CID 72888553
1-[2-chloro-5-(morpholine-4-carbonyl)phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea (PubChem CID 72888553) has the molecular formula C17H20ClN5O3 and a molecular weight of 377.83 g/mol. Its IUPAC name is 1-[2-chloro-5-(morpholine-4-carbonyl)phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-[2-chloro-5-(morpholine-4-carbonyl)phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 72888553 |
| Molecular Formula | C17H20ClN5O3 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-[2-chloro-5-(morpholine-4-carbonyl)phenyl]-3-[(1-methylpyrazol-4-yl)methyl]urea |
| SMILES | Cn1cc(CNC(=O)Nc2cc(C(=O)N3CCOCC3)ccc2Cl)cn1 |
| InChI | InChI=1S/C17H20ClN5O3/c1-22-11-12(10-20-22)9-19-17(25)21-15-8-13(2-3-14(15)18)16(24)23-4-6-26-7-5-23/h2-3,8,10-11H,4-7,9H2,1H3,(H2,19,21,25) |
| InChIKey | FGYXKBCPDSTCQF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |