C18H24FN3O3 — CID 56793894
4-fluoro-N-[3-methyl-1-[(1-methyl-6-oxopiperidin-3-yl)amino]-1-oxobutan-2-yl]benzamide (PubChem CID 56793894) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-fluoro-N-[3-methyl-1-[(1-methyl-6-oxopiperidin-3-yl)amino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[3-methyl-1-[(1-methyl-6-oxopiperidin-3-yl)amino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 56793894 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-fluoro-N-[3-methyl-1-[(1-methyl-6-oxopiperidin-3-yl)amino]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(F)cc1)C(=O)NC1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C18H24FN3O3/c1-11(2)16(21-17(24)12-4-6-13(19)7-5-12)18(25)20-14-8-9-15(23)22(3)10-14/h4-7,11,14,16H,8-10H2,1-3H3,(H,20,25)(H,21,24) |
| InChIKey | OFOOPYZDPZSHJK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |