C12H15N3O3 — CID 64668240
N-(1-methyl-6-oxopiperidin-3-yl)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 64668240) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-(1-methyl-6-oxopiperidin-3-yl)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(1-methyl-6-oxopiperidin-3-yl)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 64668240 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-(1-methyl-6-oxopiperidin-3-yl)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | CN1CC(NC(=O)c2ccc(=O)[nH]c2)CCC1=O |
| InChI | InChI=1S/C12H15N3O3/c1-15-7-9(3-5-11(15)17)14-12(18)8-2-4-10(16)13-6-8/h2,4,6,9H,3,5,7H2,1H3,(H,13,16)(H,14,18) |
| InChIKey | WSDKYBZXAFFURK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |