C13H25N5O — CID 56795480
1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-pentan-3-ylurea (PubChem CID 56795480) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-pentan-3-ylurea.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 56795480 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]pyrazol-3-yl]-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)Nc1ccn(CCN(C)C)n1 |
| InChI | InChI=1S/C13H25N5O/c1-5-11(6-2)14-13(19)15-12-7-8-18(16-12)10-9-17(3)4/h7-8,11H,5-6,9-10H2,1-4H3,(H2,14,15,16,19) |
| InChIKey | GAKDFINSVHIAEO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |