C9H12ClN5O2 — CID 59794360
N-(2-chloroethyl)-3-(2-oxoimidazolidin-1-yl)pyrazole-1-carboxamide (PubChem CID 59794360) has the molecular formula C9H12ClN5O2 and a molecular weight of 257.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-3-(2-oxoimidazolidin-1-yl)pyrazole-1-carboxamide.
| Compound Name | N-(2-chloroethyl)-3-(2-oxoimidazolidin-1-yl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 59794360 |
| Molecular Formula | C9H12ClN5O2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-(2-chloroethyl)-3-(2-oxoimidazolidin-1-yl)pyrazole-1-carboxamide |
| SMILES | O=C1NCCN1c1ccn(C(=O)NCCCl)n1 |
| InChI | InChI=1S/C9H12ClN5O2/c10-2-3-11-9(17)15-5-1-7(13-15)14-6-4-12-8(14)16/h1,5H,2-4,6H2,(H,11,17)(H,12,16) |
| InChIKey | BYBMSUCUISSWNU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|