C11H16ClN5O2 — CID 59794361
N-(3-chloropropyl)-3-(2-oxo-1,3-diazinan-1-yl)pyrazole-1-carboxamide (PubChem CID 59794361) has the molecular formula C11H16ClN5O2 and a molecular weight of 285.74 g/mol. Its IUPAC name is N-(3-chloropropyl)-3-(2-oxo-1,3-diazinan-1-yl)pyrazole-1-carboxamide.
| Compound Name | N-(3-chloropropyl)-3-(2-oxo-1,3-diazinan-1-yl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 59794361 |
| Molecular Formula | C11H16ClN5O2 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(3-chloropropyl)-3-(2-oxo-1,3-diazinan-1-yl)pyrazole-1-carboxamide |
| SMILES | O=C1NCCCN1c1ccn(C(=O)NCCCCl)n1 |
| InChI | InChI=1S/C11H16ClN5O2/c12-4-1-5-14-11(19)17-8-3-9(15-17)16-7-2-6-13-10(16)18/h3,8H,1-2,4-7H2,(H,13,18)(H,14,19) |
| InChIKey | PDTHEWWURQZEGF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|