C15H20N4O4 — CID 56796707
N-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-2-(3-oxopiperazin-1-yl)acetamide (PubChem CID 56796707) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-2-(3-oxopiperazin-1-yl)acetamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-2-(3-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 56796707 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-2-(3-oxopiperazin-1-yl)acetamide |
| SMILES | NC(=O)COc1ccc(CNC(=O)CN2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C15H20N4O4/c16-13(20)10-23-12-3-1-11(2-4-12)7-18-15(22)9-19-6-5-17-14(21)8-19/h1-4H,5-10H2,(H2,16,20)(H,17,21)(H,18,22) |
| InChIKey | ILYYGWRSIYPVNO-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |