C17H26N2O4 — CID 56798003
tert-butyl 3-[4-(2-methylfuran-3-carbonyl)piperazin-1-yl]propanoate (PubChem CID 56798003) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl 3-[4-(2-methylfuran-3-carbonyl)piperazin-1-yl]propanoate.
| Compound Name | tert-butyl 3-[4-(2-methylfuran-3-carbonyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 56798003 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl 3-[4-(2-methylfuran-3-carbonyl)piperazin-1-yl]propanoate |
| SMILES | Cc1occc1C(=O)N1CCN(CCC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H26N2O4/c1-13-14(6-12-22-13)16(21)19-10-8-18(9-11-19)7-5-15(20)23-17(2,3)4/h6,12H,5,7-11H2,1-4H3 |
| InChIKey | SRBIXJFKRMKDAG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |