C19H15F2N3O2 — CID 56798091
N'-[1-(2,4-difluorophenyl)ethyl]-N-quinolin-3-yloxamide (PubChem CID 56798091) has the molecular formula C19H15F2N3O2 and a molecular weight of 355.34 g/mol. Its IUPAC name is N'-[1-(2,4-difluorophenyl)ethyl]-N-quinolin-3-yloxamide.
| Compound Name | N'-[1-(2,4-difluorophenyl)ethyl]-N-quinolin-3-yloxamide |
|---|---|
| PubChem CID | 56798091 |
| Molecular Formula | C19H15F2N3O2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N'-[1-(2,4-difluorophenyl)ethyl]-N-quinolin-3-yloxamide |
| SMILES | CC(NC(=O)C(=O)Nc1cnc2ccccc2c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H15F2N3O2/c1-11(15-7-6-13(20)9-16(15)21)23-18(25)19(26)24-14-8-12-4-2-3-5-17(12)22-10-14/h2-11H,1H3,(H,23,25)(H,24,26) |
| InChIKey | SSTRAEXHKLUNCD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|