C27H25N3O3 — CID 56798152
2-naphthalen-1-yl-N-[2-oxo-2-[[4-(pyridin-2-ylmethoxy)phenyl]methylamino]ethyl]acetamide (PubChem CID 56798152) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-[2-oxo-2-[[4-(pyridin-2-ylmethoxy)phenyl]methylamino]ethyl]acetamide.
| Compound Name | 2-naphthalen-1-yl-N-[2-oxo-2-[[4-(pyridin-2-ylmethoxy)phenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 56798152 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-naphthalen-1-yl-N-[2-oxo-2-[[4-(pyridin-2-ylmethoxy)phenyl]methylamino]ethyl]acetamide |
| SMILES | O=C(CNC(=O)Cc1cccc2ccccc12)NCc1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C27H25N3O3/c31-26(16-22-8-5-7-21-6-1-2-10-25(21)22)30-18-27(32)29-17-20-11-13-24(14-12-20)33-19-23-9-3-4-15-28-23/h1-15H,16-19H2,(H,29,32)(H,30,31) |
| InChIKey | ATEXTAAXGFAQJM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |