C17H20N2O3S — CID 56798796
2-[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one (PubChem CID 56798796) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 56798796 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-2-oxoethyl]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2SC1CC(=O)N1CCOC2CCCC21 |
| InChI | InChI=1S/C17H20N2O3S/c20-16(19-8-9-22-13-6-3-5-12(13)19)10-15-17(21)18-11-4-1-2-7-14(11)23-15/h1-2,4,7,12-13,15H,3,5-6,8-10H2,(H,18,21) |
| InChIKey | CFDHFKCSJBHMEY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |