C15H15ClFN3O3 — CID 56798988
5-chloro-6-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]pyridine-3-carboxamide (PubChem CID 56798988) has the molecular formula C15H15ClFN3O3 and a molecular weight of 339.75 g/mol. Its IUPAC name is 5-chloro-6-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56798988 |
| Molecular Formula | C15H15ClFN3O3 |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 5-chloro-6-[[3-(4-fluorophenoxy)-2-hydroxypropyl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(NCC(O)COc2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C15H15ClFN3O3/c16-13-5-9(14(18)22)6-19-15(13)20-7-11(21)8-23-12-3-1-10(17)2-4-12/h1-6,11,21H,7-8H2,(H2,18,22)(H,19,20) |
| InChIKey | IRUZSDDIBSTUAD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |