C18H22N2O4 — CID 56799765
1-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)-2-(2-nitrophenoxy)ethanone (PubChem CID 56799765) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)-2-(2-nitrophenoxy)ethanone.
| Compound Name | 1-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)-2-(2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 56799765 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)-2-(2-nitrophenoxy)ethanone |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])N1CC2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H22N2O4/c21-18(11-24-17-4-2-1-3-16(17)20(22)23)19-10-14-6-12-5-13(7-14)9-15(19)8-12/h1-4,12-15H,5-11H2 |
| InChIKey | XHZFDBQKAIKXER-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|